C16H33N3O7 — CID 163450369
N-[2-[5-(3-aminopropylamino)-5-hydroxypentoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 163450369) has the molecular formula C16H33N3O7 and a molecular weight of 379.45 g/mol. Its IUPAC name is N-[2-[5-(3-aminopropylamino)-5-hydroxypentoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[2-[5-(3-aminopropylamino)-5-hydroxypentoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 163450369 |
| Molecular Formula | C16H33N3O7 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[2-[5-(3-aminopropylamino)-5-hydroxypentoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(OCCCCC(O)NCCCN)OC(CO)C(O)C1O |
| InChI | InChI=1S/C16H33N3O7/c1-10(21)19-13-15(24)14(23)11(9-20)26-16(13)25-8-3-2-5-12(22)18-7-4-6-17/h11-16,18,20,22-24H,2-9,17H2,1H3,(H,19,21) |
| InChIKey | BGBQJHJICJKIAJ-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 166.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|