C12H23N — CID 163450609
(2E)-1,3-dimethyl-1-azacycloundec-2-ene (PubChem CID 163450609) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (2E)-1,3-dimethyl-1-azacycloundec-2-ene.
| Compound Name | (2E)-1,3-dimethyl-1-azacycloundec-2-ene |
|---|---|
| PubChem CID | 163450609 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (2E)-1,3-dimethyl-1-azacycloundec-2-ene |
| SMILES | C/C1=C\N(C)CCCCCCCC1 |
| InChI | InChI=1S/C12H23N/c1-12-9-7-5-3-4-6-8-10-13(2)11-12/h11H,3-10H2,1-2H3/b12-11+ |
| InChIKey | BGGSNOLCZJKNOL-VAWYXSNFSA-N |
| XLogP | 3.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |