C7H14N2 — CID 59165083
2,7-dimethyl-3,4,5,6-tetrahydrodiazepine (PubChem CID 59165083) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2,7-dimethyl-3,4,5,6-tetrahydrodiazepine.
| Compound Name | 2,7-dimethyl-3,4,5,6-tetrahydrodiazepine |
|---|---|
| PubChem CID | 59165083 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2,7-dimethyl-3,4,5,6-tetrahydrodiazepine |
| SMILES | CC1=NN(C)CCCC1 |
| InChI | InChI=1S/C7H14N2/c1-7-5-3-4-6-9(2)8-7/h3-6H2,1-2H3 |
| InChIKey | ORGDXZSZUJMZJC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |