C17H13Cl2N5O2S — CID 163452586
N-carbonochloridimidoyl-1-[[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]oxy]methanimidoyl chloride (PubChem CID 163452586) has the molecular formula C17H13Cl2N5O2S and a molecular weight of 422.30 g/mol. Its IUPAC name is N-carbonochloridimidoyl-1-[[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]oxy]methanimidoyl chloride.
| Compound Name | N-carbonochloridimidoyl-1-[[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]oxy]methanimidoyl chloride |
|---|---|
| PubChem CID | 163452586 |
| Molecular Formula | C17H13Cl2N5O2S |
| Molecular Weight | 422.30 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | N-carbonochloridimidoyl-1-[[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]oxy]methanimidoyl chloride |
| SMILES | [H]/N=C(\Cl)N=C(Cl)Oc1ccc2c(ccc3sc4c(c32)NC[C@@H](C)NC4=O)n1 |
| InChI | InChI=1S/C17H13Cl2N5O2S/c1-7-6-21-13-12-8-2-5-11(26-17(19)24-16(18)20)23-9(8)3-4-10(12)27-14(13)15(25)22-7/h2-5,7,20-21H,6H2,1H3,(H,22,25)/b20-16+,24-17?/t7-/m1/s1 |
| InChIKey | BHUXQWDENHTLJH-OGAPHOKGSA-N |
| XLogP | 4.14 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|