C20H20N6OS — CID 171542184
N-ethanimidoyl-N-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]prop-2-enimidamide (PubChem CID 171542184) has the molecular formula C20H20N6OS and a molecular weight of 392.49 g/mol. Its IUPAC name is N-ethanimidoyl-N-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]prop-2-enimidamide.
| Compound Name | N-ethanimidoyl-N-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]prop-2-enimidamide |
|---|---|
| PubChem CID | 171542184 |
| Molecular Formula | C20H20N6OS |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-ethanimidoyl-N-[(15R)-15-methyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]prop-2-enimidamide |
| SMILES | [H]/N=C(\C)N(/C(C=C)=N/[H])c1ccc2c(ccc3sc4c(c32)NC[C@@H](C)NC4=O)n1 |
| InChI | InChI=1S/C20H20N6OS/c1-4-15(22)26(11(3)21)16-8-5-12-13(25-16)6-7-14-17(12)18-19(28-14)20(27)24-10(2)9-23-18/h4-8,10,21-23H,1,9H2,2-3H3,(H,24,27)/b21-11+,22-15+/t10-/m1/s1 |
| InChIKey | UQRWQJDFCZWIAT-YYZSVGTISA-N |
| XLogP | 3.96 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|