C24H26N4OS — CID 144714966
(15R)-5-(2-amino-4-methylphenyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one;ethane (PubChem CID 144714966) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is (15R)-5-(2-amino-4-methylphenyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one;ethane.
| Compound Name | (15R)-5-(2-amino-4-methylphenyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one;ethane |
|---|---|
| PubChem CID | 144714966 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (15R)-5-(2-amino-4-methylphenyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one;ethane |
| SMILES | CC.Cc1ccc(-c2ccc3c(ccc4sc5c(c43)NC[C@@H](C)NC5=O)n2)c(N)c1 |
| InChI | InChI=1S/C22H20N4OS.C2H6/c1-11-3-4-13(15(23)9-11)16-6-5-14-17(26-16)7-8-18-19(14)20-21(28-18)22(27)25-12(2)10-24-20;1-2/h3-9,12,24H,10,23H2,1-2H3,(H,25,27);1-2H3/t12-;/m1./s1 |
| InChIKey | UCZAXIGSTRYGDL-UTONKHPSSA-N |
| XLogP | 5.58 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|