C23H18N4OS — CID 171542293
(15R)-5-(2-ethynyl-5-methyl-4-pyridinyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 171542293) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is (15R)-5-(2-ethynyl-5-methyl-4-pyridinyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15R)-5-(2-ethynyl-5-methyl-4-pyridinyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 171542293 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (15R)-5-(2-ethynyl-5-methyl-4-pyridinyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | C#Cc1cc(-c2ccc3c(ccc4sc5c(c43)NC[C@@H](C)NC5=O)n2)c(C)cn1 |
| InChI | InChI=1S/C23H18N4OS/c1-4-14-9-16(12(2)10-24-14)18-6-5-15-17(27-18)7-8-19-20(15)21-22(29-19)23(28)26-13(3)11-25-21/h1,5-10,13,25H,11H2,2-3H3,(H,26,28)/t13-/m1/s1 |
| InChIKey | YAJDXWWVQTVUAE-CYBMUJFWSA-N |
| XLogP | 4.35 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|