C13H24O2 — CID 163456657
8-butan-2-yl-3-methyl-1,4-dioxaspiro[4.5]decane (PubChem CID 163456657) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 8-butan-2-yl-3-methyl-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-butan-2-yl-3-methyl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 163456657 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 8-butan-2-yl-3-methyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CCC(C)C1CCC2(CC1)OCC(C)O2 |
| InChI | InChI=1S/C13H24O2/c1-4-10(2)12-5-7-13(8-6-12)14-9-11(3)15-13/h10-12H,4-9H2,1-3H3 |
| InChIKey | BLBQINCRSMYMTN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |