C15H19NO4 — CID 163459756
N,N-diethyl-4,7-dimethoxy-1-benzofuran-2-carboxamide (PubChem CID 163459756) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is N,N-diethyl-4,7-dimethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N,N-diethyl-4,7-dimethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 163459756 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N,N-diethyl-4,7-dimethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2c(OC)ccc(OC)c2o1 |
| InChI | InChI=1S/C15H19NO4/c1-5-16(6-2)15(17)13-9-10-11(18-3)7-8-12(19-4)14(10)20-13/h7-9H,5-6H2,1-4H3 |
| InChIKey | PTTOLMIUXBKICS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |