C27H26FN5 — CID 163460132
N-[1-[[2-(2-fluorophenyl)imino-5-methylidene-3-phenylimidazolidin-4-ylidene]amino]ethenyl]-3-phenylpropan-1-amine (PubChem CID 163460132) has the molecular formula C27H26FN5 and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[1-[[2-(2-fluorophenyl)imino-5-methylidene-3-phenylimidazolidin-4-ylidene]amino]ethenyl]-3-phenylpropan-1-amine.
| Compound Name | N-[1-[[2-(2-fluorophenyl)imino-5-methylidene-3-phenylimidazolidin-4-ylidene]amino]ethenyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 163460132 |
| Molecular Formula | C27H26FN5 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | N-[1-[[2-(2-fluorophenyl)imino-5-methylidene-3-phenylimidazolidin-4-ylidene]amino]ethenyl]-3-phenylpropan-1-amine |
| SMILES | C=C(N=C1C(=C)N/C(=N\c2ccccc2F)N1c1ccccc1)NCCCc1ccccc1 |
| InChI | InChI=1S/C27H26FN5/c1-20-26(31-21(2)29-19-11-14-22-12-5-3-6-13-22)33(23-15-7-4-8-16-23)27(30-20)32-25-18-10-9-17-24(25)28/h3-10,12-13,15-18,29H,1-2,11,14,19H2,(H,30,32) |
| InChIKey | BNWARTZOZPXWQT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|