C28H22N8O3 — CID 163460373
N-[3-(3-methylimidazo[1,2-b]pyridazin-6-yl)phenyl]-2-[3-methyl-6-(3-nitrophenyl)imidazo[1,2-b]pyridazin-2-yl]acetamide (PubChem CID 163460373) has the molecular formula C28H22N8O3 and a molecular weight of 518.54 g/mol. Its IUPAC name is N-[3-(3-methylimidazo[1,2-b]pyridazin-6-yl)phenyl]-2-[3-methyl-6-(3-nitrophenyl)imidazo[1,2-b]pyridazin-2-yl]acetamide.
| Compound Name | N-[3-(3-methylimidazo[1,2-b]pyridazin-6-yl)phenyl]-2-[3-methyl-6-(3-nitrophenyl)imidazo[1,2-b]pyridazin-2-yl]acetamide |
|---|---|
| PubChem CID | 163460373 |
| Molecular Formula | C28H22N8O3 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[3-(3-methylimidazo[1,2-b]pyridazin-6-yl)phenyl]-2-[3-methyl-6-(3-nitrophenyl)imidazo[1,2-b]pyridazin-2-yl]acetamide |
| SMILES | Cc1cnc2ccc(-c3cccc(NC(=O)Cc4nc5ccc(-c6cccc([N+](=O)[O-])c6)nn5c4C)c3)nn12 |
| InChI | InChI=1S/C28H22N8O3/c1-17-16-29-26-11-9-23(32-34(17)26)19-5-3-7-21(13-19)30-28(37)15-25-18(2)35-27(31-25)12-10-24(33-35)20-6-4-8-22(14-20)36(38)39/h3-14,16H,15H2,1-2H3,(H,30,37) |
| InChIKey | BOBDTHIHGJFRCV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 132.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|