About 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine
2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine (PubChem CID 163461668) has the molecular formula C16H18FN3
and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine.
Molecular Properties
| Compound Name | 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine |
| PubChem CID | 163461668 |
| Molecular Formula | C16H18FN3 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine |
| SMILES | C/C=C(Cn1nc(-c2ccccn2)cc1C)\C(F)=C/C |
| InChI | InChI=1S/C16H18FN3/c1-4-13(14(17)5-2)11-20-12(3)10-16(19-20)15-8-6-7-9-18-15/h4-10H,11H2,1-3H3/b13-4-,14-5+ |
| InChIKey | BPCBUILUEVFZSK-YCKHSYMTSA-N |
| XLogP | 4.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine?
The IUPAC name of 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine (CID 163461668) is 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine.
What is the SMILES notation for 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine?
The canonical SMILES for 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine is C/C=C(Cn1nc(-c2ccccn2)cc1C)\C(F)=C/C.
What is the InChIKey of 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine?
The InChIKey is BPCBUILUEVFZSK-YCKHSYMTSA-N. The full InChI is InChI=1S/C16H18FN3/c1-4-13(14(17)5-2)11-20-12(3)10-16(19-20)15-8-6-7-9-18-15/h4-10H,11H2,1-3H3/b13-4-,14-5+.
What are the key properties of 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine?
2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine has a molecular weight of 271.34 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine is sourced from PubChem (CID 163461668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).