C16H18FN3 — CID 163461668
2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine (PubChem CID 163461668) has the molecular formula C16H18FN3 and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine.
| Compound Name | 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 163461668 |
| Molecular Formula | C16H18FN3 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[1-[(E,2Z)-2-ethylidene-3-fluoropent-3-enyl]-5-methylpyrazol-3-yl]pyridine |
| SMILES | C/C=C(Cn1nc(-c2ccccn2)cc1C)\C(F)=C/C |
| InChI | InChI=1S/C16H18FN3/c1-4-13(14(17)5-2)11-20-12(3)10-16(19-20)15-8-6-7-9-18-15/h4-10H,11H2,1-3H3/b13-4-,14-5+ |
| InChIKey | BPCBUILUEVFZSK-YCKHSYMTSA-N |
| XLogP | 4.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|