C12H4Cl2F3IN4 — CID 163462664
3-chloro-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-6-iodoimidazo[4,5-b]pyridine (PubChem CID 163462664) has the molecular formula C12H4Cl2F3IN4 and a molecular weight of 459.00 g/mol. Its IUPAC name is 3-chloro-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-6-iodoimidazo[4,5-b]pyridine.
| Compound Name | 3-chloro-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-6-iodoimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 163462664 |
| Molecular Formula | C12H4Cl2F3IN4 |
| Molecular Weight | 459.00 g/mol |
| Exact Mass | 457.88 |
| IUPAC Name | 3-chloro-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-6-iodoimidazo[4,5-b]pyridine |
| SMILES | FC(F)(F)c1cnc(-c2nc3cc(I)cnc3n2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H4Cl2F3IN4/c13-7-1-5(12(15,16)17)3-19-9(7)11-21-8-2-6(18)4-20-10(8)22(11)14/h1-4H |
| InChIKey | NEXFPXQYTNUGEP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.00 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|