C10H20NO+ — CID 163463714
[4-(2-aminopropyl)-6-methylcyclohex-3-en-1-yl]oxidanium (PubChem CID 163463714) has the molecular formula C10H20NO+ and a molecular weight of 170.28 g/mol. Its IUPAC name is [4-(2-aminopropyl)-6-methylcyclohex-3-en-1-yl]oxidanium.
| Compound Name | [4-(2-aminopropyl)-6-methylcyclohex-3-en-1-yl]oxidanium |
|---|---|
| PubChem CID | 163463714 |
| Molecular Formula | C10H20NO+ |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | [4-(2-aminopropyl)-6-methylcyclohex-3-en-1-yl]oxidanium |
| SMILES | CC(N)CC1=CCC([OH2+])C(C)C1 |
| InChI | InChI=1S/C10H19NO/c1-7-5-9(6-8(2)11)3-4-10(7)12/h3,7-8,10,12H,4-6,11H2,1-2H3/p+1 |
| InChIKey | BQSZPNYMCBSREG-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 48.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|