C9H17NO2 — CID 21325371
4-(2-aminopropyl)cyclohex-4-ene-1,2-diol (PubChem CID 21325371) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-(2-aminopropyl)cyclohex-4-ene-1,2-diol.
| Compound Name | 4-(2-aminopropyl)cyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 21325371 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 4-(2-aminopropyl)cyclohex-4-ene-1,2-diol |
| SMILES | CC(N)CC1=CCC(O)C(O)C1 |
| InChI | InChI=1S/C9H17NO2/c1-6(10)4-7-2-3-8(11)9(12)5-7/h2,6,8-9,11-12H,3-5,10H2,1H3 |
| InChIKey | RXTPOFSLHNXFHT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|