C13H27FN2O2 — CID 91464035
3,9-diamino-4-ethyl-2-fluoro-6,7-dimethylnon-7-ene-2,5-diol (PubChem CID 91464035) has the molecular formula C13H27FN2O2 and a molecular weight of 262.37 g/mol. Its IUPAC name is 3,9-diamino-4-ethyl-2-fluoro-6,7-dimethylnon-7-ene-2,5-diol.
| Compound Name | 3,9-diamino-4-ethyl-2-fluoro-6,7-dimethylnon-7-ene-2,5-diol |
|---|---|
| PubChem CID | 91464035 |
| Molecular Formula | C13H27FN2O2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 3,9-diamino-4-ethyl-2-fluoro-6,7-dimethylnon-7-ene-2,5-diol |
| SMILES | CCC(C(O)C(C)C(C)=CCN)C(N)C(C)(O)F |
| InChI | InChI=1S/C13H27FN2O2/c1-5-10(12(16)13(4,14)18)11(17)9(3)8(2)6-7-15/h6,9-12,17-18H,5,7,15-16H2,1-4H3 |
| InChIKey | RVXVDFLXNZELJV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|