C22H43NO3 — CID 71439868
2-amino-5,9,13,17-tetramethyloctadeca-8,16-diene-1,3,14-triol (PubChem CID 71439868) has the molecular formula C22H43NO3 and a molecular weight of 369.59 g/mol. Its IUPAC name is 2-amino-5,9,13,17-tetramethyloctadeca-8,16-diene-1,3,14-triol.
| Compound Name | 2-amino-5,9,13,17-tetramethyloctadeca-8,16-diene-1,3,14-triol |
|---|---|
| PubChem CID | 71439868 |
| Molecular Formula | C22H43NO3 |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.32 |
| IUPAC Name | 2-amino-5,9,13,17-tetramethyloctadeca-8,16-diene-1,3,14-triol |
| SMILES | CC(C)=CCC(O)C(C)CCCC(C)=CCCC(C)CC(O)C(N)CO |
| InChI | InChI=1S/C22H43NO3/c1-16(2)12-13-21(25)19(5)11-7-9-17(3)8-6-10-18(4)14-22(26)20(23)15-24/h8,12,18-22,24-26H,6-7,9-11,13-15,23H2,1-5H3 |
| InChIKey | ASNURABVVXFZSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|