C20H39NO2 — CID 91231793
2-aminoicosa-11,14-diene-1,3-diol (PubChem CID 91231793) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is 2-aminoicosa-11,14-diene-1,3-diol.
| Compound Name | 2-aminoicosa-11,14-diene-1,3-diol |
|---|---|
| PubChem CID | 91231793 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | 2-aminoicosa-11,14-diene-1,3-diol |
| SMILES | CCCCCC=CCC=CCCCCCCCC(O)C(N)CO |
| InChI | InChI=1S/C20H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(21)18-22/h6-7,9-10,19-20,22-23H,2-5,8,11-18,21H2,1H3 |
| InChIKey | LBIXQGUSZXVUKN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|