C13H10N4O3 — CID 163466681
2-[(5-oxo-4H-1,2,4-triazin-6-yl)methyl]-4H-isoquinoline-1,3-dione (PubChem CID 163466681) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-[(5-oxo-4H-1,2,4-triazin-6-yl)methyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 2-[(5-oxo-4H-1,2,4-triazin-6-yl)methyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 163466681 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[(5-oxo-4H-1,2,4-triazin-6-yl)methyl]-4H-isoquinoline-1,3-dione |
| SMILES | O=C1Cc2ccccc2C(=O)N1Cc1nnc[nH]c1=O |
| InChI | InChI=1S/C13H10N4O3/c18-11-5-8-3-1-2-4-9(8)13(20)17(11)6-10-12(19)14-7-15-16-10/h1-4,7H,5-6H2,(H,14,15,19) |
| InChIKey | BTEUCJPGFSLSQZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|