About 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol
4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol (PubChem CID 163467451) has the molecular formula C11H16FNO
and a molecular weight of 197.25 g/mol. Its IUPAC name is 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol |
| PubChem CID | 163467451 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol |
| SMILES | C[C@H](c1ccc(O)cc1)[C@@](C)(N)CF |
| InChI | InChI=1S/C11H16FNO/c1-8(11(2,13)7-12)9-3-5-10(14)6-4-9/h3-6,8,14H,7,13H2,1-2H3/t8-,11+/m1/s1 |
| InChIKey | YJUJMHAXFCHLGT-KCJUWKMLSA-N |
| XLogP | 2.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol?
The IUPAC name of 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol (CID 163467451) is 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol.
What is the SMILES notation for 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol?
The canonical SMILES for 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol is C[C@H](c1ccc(O)cc1)[C@@](C)(N)CF.
What is the InChIKey of 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol?
The InChIKey is YJUJMHAXFCHLGT-KCJUWKMLSA-N. The full InChI is InChI=1S/C11H16FNO/c1-8(11(2,13)7-12)9-3-5-10(14)6-4-9/h3-6,8,14H,7,13H2,1-2H3/t8-,11+/m1/s1.
What are the key properties of 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol?
4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol has a molecular weight of 197.25 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,3R)-3-amino-4-fluoro-3-methylbutan-2-yl]phenol is sourced from PubChem (CID 163467451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).