C31H32O3 — CID 172743360
4-[2-(4-hydroxyphenyl)-2-[4-[3-(4-hydroxyphenyl)-3-methylbutan-2-yl]phenyl]ethyl]phenol (PubChem CID 172743360) has the molecular formula C31H32O3 and a molecular weight of 452.59 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)-2-[4-[3-(4-hydroxyphenyl)-3-methylbutan-2-yl]phenyl]ethyl]phenol.
| Compound Name | 4-[2-(4-hydroxyphenyl)-2-[4-[3-(4-hydroxyphenyl)-3-methylbutan-2-yl]phenyl]ethyl]phenol |
|---|---|
| PubChem CID | 172743360 |
| Molecular Formula | C31H32O3 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)-2-[4-[3-(4-hydroxyphenyl)-3-methylbutan-2-yl]phenyl]ethyl]phenol |
| SMILES | CC(c1ccc(C(Cc2ccc(O)cc2)c2ccc(O)cc2)cc1)C(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C31H32O3/c1-21(31(2,3)26-12-18-29(34)19-13-26)23-6-8-24(9-7-23)30(25-10-16-28(33)17-11-25)20-22-4-14-27(32)15-5-22/h4-19,21,30,32-34H,20H2,1-3H3 |
| InChIKey | JJVHNBRGTIWSKE-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |