C31H37N3O2S3 — CID 163468752
6-[(10-benzylacridin-9-ylidene)-(3-methoxysulfanylpropylsulfanyl)methyl]sulfanylhexanehydrazide (PubChem CID 163468752) has the molecular formula C31H37N3O2S3 and a molecular weight of 579.86 g/mol. Its IUPAC name is 6-[(10-benzylacridin-9-ylidene)-(3-methoxysulfanylpropylsulfanyl)methyl]sulfanylhexanehydrazide.
| Compound Name | 6-[(10-benzylacridin-9-ylidene)-(3-methoxysulfanylpropylsulfanyl)methyl]sulfanylhexanehydrazide |
|---|---|
| PubChem CID | 163468752 |
| Molecular Formula | C31H37N3O2S3 |
| Molecular Weight | 579.86 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 6-[(10-benzylacridin-9-ylidene)-(3-methoxysulfanylpropylsulfanyl)methyl]sulfanylhexanehydrazide |
| SMILES | COSCCCSC(SCCCCCC(=O)NN)=C1c2ccccc2N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H37N3O2S3/c1-36-39-22-12-21-38-31(37-20-11-3-6-19-29(35)33-32)30-25-15-7-9-17-27(25)34(23-24-13-4-2-5-14-24)28-18-10-8-16-26(28)30/h2,4-5,7-10,13-18H,3,6,11-12,19-23,32H2,1H3,(H,33,35) |
| InChIKey | BUVSZVBUXQGWJH-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.86 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|