C35H37N3O3S — CID 59215581
N-[3-[1-(10-benzylacridin-9-ylidene)ethylsulfanyl]propyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 59215581) has the molecular formula C35H37N3O3S and a molecular weight of 579.77 g/mol. Its IUPAC name is N-[3-[1-(10-benzylacridin-9-ylidene)ethylsulfanyl]propyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | N-[3-[1-(10-benzylacridin-9-ylidene)ethylsulfanyl]propyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 59215581 |
| Molecular Formula | C35H37N3O3S |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | N-[3-[1-(10-benzylacridin-9-ylidene)ethylsulfanyl]propyl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | CC(SCCCNC(=O)CCCCCN1C(=O)C=CC1=O)=C1c2ccccc2N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C35H37N3O3S/c1-26(42-24-12-22-36-32(39)19-6-3-11-23-37-33(40)20-21-34(37)41)35-28-15-7-9-17-30(28)38(25-27-13-4-2-5-14-27)31-18-10-8-16-29(31)35/h2,4-5,7-10,13-18,20-21H,3,6,11-12,19,22-25H2,1H3,(H,36,39) |
| InChIKey | OLAVVJNKYYSMJN-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|