C27H26BrClN4O2 — CID 163470759
7-bromo-6-chloro-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one (PubChem CID 163470759) has the molecular formula C27H26BrClN4O2 and a molecular weight of 553.89 g/mol. Its IUPAC name is 7-bromo-6-chloro-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one.
| Compound Name | 7-bromo-6-chloro-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one |
|---|---|
| PubChem CID | 163470759 |
| Molecular Formula | C27H26BrClN4O2 |
| Molecular Weight | 553.89 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 7-bromo-6-chloro-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one |
| SMILES | [C-]#[N+]c1c(N2CCN(C(=O)C=C)C[C@@H]2C)c2cc(Cl)c(Br)cc2n(-c2ccccc2C(C)C)c1=O |
| InChI | InChI=1S/C27H26BrClN4O2/c1-6-24(34)31-11-12-32(17(4)15-31)26-19-13-21(29)20(28)14-23(19)33(27(35)25(26)30-5)22-10-8-7-9-18(22)16(2)3/h6-10,13-14,16-17H,1,11-12,15H2,2-4H3/t17-/m0/s1 |
| InChIKey | KHMWYNZEBKBMFV-KRWDZBQOSA-N |
| XLogP | 6.30 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.89 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|