C33H31Cl2N5O2 — CID 163547412
7-(2-amino-4-chlorophenyl)-6-chloro-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one (PubChem CID 163547412) has the molecular formula C33H31Cl2N5O2 and a molecular weight of 600.55 g/mol. Its IUPAC name is 7-(2-amino-4-chlorophenyl)-6-chloro-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one.
| Compound Name | 7-(2-amino-4-chlorophenyl)-6-chloro-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one |
|---|---|
| PubChem CID | 163547412 |
| Molecular Formula | C33H31Cl2N5O2 |
| Molecular Weight | 600.55 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | 7-(2-amino-4-chlorophenyl)-6-chloro-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one |
| SMILES | [C-]#[N+]c1c(N2CCN(C(=O)C=C)C[C@@H]2C)c2cc(Cl)c(-c3ccc(Cl)cc3N)cc2n(-c2ccccc2C(C)C)c1=O |
| InChI | InChI=1S/C33H31Cl2N5O2/c1-6-30(41)38-13-14-39(20(4)18-38)32-25-16-26(35)24(23-12-11-21(34)15-27(23)36)17-29(25)40(33(42)31(32)37-5)28-10-8-7-9-22(28)19(2)3/h6-12,15-17,19-20H,1,13-14,18,36H2,2-4H3/t20-/m0/s1 |
| InChIKey | GXFDJBTZNVBHGD-FQEVSTJZSA-N |
| XLogP | 7.44 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.55 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|