C36H35ClN4O2 — CID 163507758
6-chloro-7-(2-cyclopropylphenyl)-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one (PubChem CID 163507758) has the molecular formula C36H35ClN4O2 and a molecular weight of 591.16 g/mol. Its IUPAC name is 6-chloro-7-(2-cyclopropylphenyl)-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one.
| Compound Name | 6-chloro-7-(2-cyclopropylphenyl)-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one |
|---|---|
| PubChem CID | 163507758 |
| Molecular Formula | C36H35ClN4O2 |
| Molecular Weight | 591.16 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 6-chloro-7-(2-cyclopropylphenyl)-3-isocyano-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-1-(2-propan-2-ylphenyl)quinolin-2-one |
| SMILES | [C-]#[N+]c1c(N2CCN(C(=O)C=C)C[C@@H]2C)c2cc(Cl)c(-c3ccccc3C3CC3)cc2n(-c2ccccc2C(C)C)c1=O |
| InChI | InChI=1S/C36H35ClN4O2/c1-6-33(42)39-17-18-40(23(4)21-39)35-29-19-30(37)28(27-13-8-7-12-26(27)24-15-16-24)20-32(29)41(36(43)34(35)38-5)31-14-10-9-11-25(31)22(2)3/h6-14,19-20,22-24H,1,15-18,21H2,2-4H3/t23-/m0/s1 |
| InChIKey | CZZMGXNOXUXFPV-QHCPKHFHSA-N |
| XLogP | 8.09 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.16 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|