C49H33N5O2 — CID 163472098
2-[7-[4-(1-methylcyclohexa-2,4-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-3-yl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 163472098) has the molecular formula C49H33N5O2 and a molecular weight of 723.84 g/mol. Its IUPAC name is 2-[7-[4-(1-methylcyclohexa-2,4-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-3-yl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[7-[4-(1-methylcyclohexa-2,4-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-3-yl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 163472098 |
| Molecular Formula | C49H33N5O2 |
| Molecular Weight | 723.84 g/mol |
| Exact Mass | 723.26 |
| IUPAC Name | 2-[7-[4-(1-methylcyclohexa-2,4-dien-1-yl)-6-phenyl-1,3,5-triazin-2-yl]spiro[fluorene-9,9'-xanthene]-3-yl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | CC1(c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C3(c5ccccc5Oc5ccccc53)c3ccc(-c5nnc(-c6ccccc6)o5)cc3-4)n2)C=CC=CC1 |
| InChI | InChI=1S/C49H33N5O2/c1-48(27-13-4-14-28-48)47-51-43(31-15-5-2-6-16-31)50-44(52-47)33-23-25-35-36-29-34(46-54-53-45(56-46)32-17-7-3-8-18-32)24-26-37(36)49(40(35)30-33)38-19-9-11-21-41(38)55-42-22-12-10-20-39(42)49/h2-27,29-30H,28H2,1H3 |
| InChIKey | BXIZYHSOBJXVTG-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 86.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.84 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |