C19H26O2 — CID 163472773
3-(1,8a-dihydronaphthalen-2-yl)pentan-3-yl 2-methylpropanoate (PubChem CID 163472773) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-(1,8a-dihydronaphthalen-2-yl)pentan-3-yl 2-methylpropanoate.
| Compound Name | 3-(1,8a-dihydronaphthalen-2-yl)pentan-3-yl 2-methylpropanoate |
|---|---|
| PubChem CID | 163472773 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 3-(1,8a-dihydronaphthalen-2-yl)pentan-3-yl 2-methylpropanoate |
| SMILES | CCC(CC)(OC(=O)C(C)C)C1=CC=C2C=CC=CC2C1 |
| InChI | InChI=1S/C19H26O2/c1-5-19(6-2,21-18(20)14(3)4)17-12-11-15-9-7-8-10-16(15)13-17/h7-12,14,16H,5-6,13H2,1-4H3 |
| InChIKey | BXXRXJAYIISKHC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |