C32H34FNO3 — CID 163478558
tert-butyl 2-[(1R,2S)-2-[(3-fluorophenyl)-isocyano-(4-phenylmethoxyphenyl)methyl]cyclopentyl]acetate (PubChem CID 163478558) has the molecular formula C32H34FNO3 and a molecular weight of 499.63 g/mol. Its IUPAC name is tert-butyl 2-[(1R,2S)-2-[(3-fluorophenyl)-isocyano-(4-phenylmethoxyphenyl)methyl]cyclopentyl]acetate.
| Compound Name | tert-butyl 2-[(1R,2S)-2-[(3-fluorophenyl)-isocyano-(4-phenylmethoxyphenyl)methyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 163478558 |
| Molecular Formula | C32H34FNO3 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | tert-butyl 2-[(1R,2S)-2-[(3-fluorophenyl)-isocyano-(4-phenylmethoxyphenyl)methyl]cyclopentyl]acetate |
| SMILES | [C-]#[N+]C(c1ccc(OCc2ccccc2)cc1)(c1cccc(F)c1)[C@H]1CCC[C@@H]1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H34FNO3/c1-31(2,3)37-30(35)20-24-12-8-15-29(24)32(34-4,26-13-9-14-27(33)21-26)25-16-18-28(19-17-25)36-22-23-10-6-5-7-11-23/h5-7,9-11,13-14,16-19,21,24,29H,8,12,15,20,22H2,1-3H3/t24-,29+,32?/m1/s1 |
| InChIKey | RIGJSDKZAZPTBF-HZBHUSIDSA-N |
| XLogP | 7.72 |
| TPSA | 39.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|