C18H31BrO6 — CID 163478578
(3aR,5S,6S,7aS)-6-(5-bromopentoxy)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran (PubChem CID 163478578) has the molecular formula C18H31BrO6 and a molecular weight of 423.34 g/mol. Its IUPAC name is (3aR,5S,6S,7aS)-6-(5-bromopentoxy)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran.
| Compound Name | (3aR,5S,6S,7aS)-6-(5-bromopentoxy)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
|---|---|
| PubChem CID | 163478578 |
| Molecular Formula | C18H31BrO6 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (3aR,5S,6S,7aS)-6-(5-bromopentoxy)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@@H](OCCCCCBr)C[C@@H]2O1 |
| InChI | InChI=1S/C18H31BrO6/c1-17(2)21-11-14(24-17)15-12(20-9-7-5-6-8-19)10-13-16(22-15)25-18(3,4)23-13/h12-16H,5-11H2,1-4H3/t12-,13-,14+,15-,16+/m0/s1 |
| InChIKey | CCPDOMIPJWWORZ-ARKGTOAJSA-N |
| XLogP | 3.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|