C24H29N3O3S — CID 163478736
(E)-N-[6-butanoyl-3-[(methylideneamino)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(2-ethoxyphenyl)prop-2-enamide (PubChem CID 163478736) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is (E)-N-[6-butanoyl-3-[(methylideneamino)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(2-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[6-butanoyl-3-[(methylideneamino)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 163478736 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (E)-N-[6-butanoyl-3-[(methylideneamino)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]-3-(2-ethoxyphenyl)prop-2-enamide |
| SMILES | C=NCc1c(NC(=O)/C=C/c2ccccc2OCC)sc2c1CCN(C(=O)CCC)C2 |
| InChI | InChI=1S/C24H29N3O3S/c1-4-8-23(29)27-14-13-18-19(15-25-3)24(31-21(18)16-27)26-22(28)12-11-17-9-6-7-10-20(17)30-5-2/h6-7,9-12H,3-5,8,13-16H2,1-2H3,(H,26,28)/b12-11+ |
| InChIKey | CCSJQKRALNVCPC-VAWYXSNFSA-N |
| XLogP | 4.68 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|