C23H27N3O3S — CID 89032904
(E)-N-(6-butanoyl-3-cyano-3,4,5,7-tetrahydro-2H-thieno[2,3-c]pyridin-2-yl)-3-(2-ethoxyphenyl)prop-2-enamide (PubChem CID 89032904) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is (E)-N-(6-butanoyl-3-cyano-3,4,5,7-tetrahydro-2H-thieno[2,3-c]pyridin-2-yl)-3-(2-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-butanoyl-3-cyano-3,4,5,7-tetrahydro-2H-thieno[2,3-c]pyridin-2-yl)-3-(2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 89032904 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (E)-N-(6-butanoyl-3-cyano-3,4,5,7-tetrahydro-2H-thieno[2,3-c]pyridin-2-yl)-3-(2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCCC(=O)N1CCC2=C(C1)SC(NC(=O)/C=C/c1ccccc1OCC)C2C#N |
| InChI | InChI=1S/C23H27N3O3S/c1-3-7-22(28)26-13-12-17-18(14-24)23(30-20(17)15-26)25-21(27)11-10-16-8-5-6-9-19(16)29-4-2/h5-6,8-11,18,23H,3-4,7,12-13,15H2,1-2H3,(H,25,27)/b11-10+ |
| InChIKey | HEGQPPBVWGKMIK-ZHACJKMWSA-N |
| XLogP | 3.71 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|