About 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone
1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone (PubChem CID 163480534) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone.
Analyze 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone?
The IUPAC name of 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone (CID 163480534) is 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone.
What is the SMILES notation for 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone?
The canonical SMILES for 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone is COC1OC2C3CC(CC13)C2C(C)=O.
What is the InChIKey of 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone?
The InChIKey is CEDOVEGZXMXRPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-5(12)9-6-3-7-8(4-6)11(13-2)14-10(7)9/h6-11H,3-4H2,1-2H3.
What are the key properties of 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone?
1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone has a molecular weight of 196.25 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methoxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)ethanone is sourced from PubChem (CID 163480534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).