C16H22O3 — CID 11658976
[1-[(1R,2R,3S,4S,5R,6S)-6-acetyl-3-tricyclo[3.2.1.02,4]octanyl]-2-methylprop-1-enyl] acetate (PubChem CID 11658976) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is [1-[(1R,2R,3S,4S,5R,6S)-6-acetyl-3-tricyclo[3.2.1.02,4]octanyl]-2-methylprop-1-enyl] acetate.
| Compound Name | [1-[(1R,2R,3S,4S,5R,6S)-6-acetyl-3-tricyclo[3.2.1.02,4]octanyl]-2-methylprop-1-enyl] acetate |
|---|---|
| PubChem CID | 11658976 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [1-[(1R,2R,3S,4S,5R,6S)-6-acetyl-3-tricyclo[3.2.1.02,4]octanyl]-2-methylprop-1-enyl] acetate |
| SMILES | CC(=O)OC(=C(C)C)[C@@H]1[C@H]2[C@H]3C[C@H](C[C@@H]3C(C)=O)[C@@H]12 |
| InChI | InChI=1S/C16H22O3/c1-7(2)16(19-9(4)18)15-13-10-5-11(8(3)17)12(6-10)14(13)15/h10-15H,5-6H2,1-4H3/t10-,11+,12-,13+,14-,15-/m0/s1 |
| InChIKey | NPMMQSRXGCQVES-DEPYFDJDSA-N |
| XLogP | 2.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|