C20H26O8 — CID 11524042
[1-[(1S,2S,4R,5R)-6,7-bis(methoxycarbonyloxymethyl)-3-tricyclo[3.2.1.02,4]oct-6-enyl]-2-methylprop-1-enyl] acetate (PubChem CID 11524042) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is [1-[(1S,2S,4R,5R)-6,7-bis(methoxycarbonyloxymethyl)-3-tricyclo[3.2.1.02,4]oct-6-enyl]-2-methylprop-1-enyl] acetate.
| Compound Name | [1-[(1S,2S,4R,5R)-6,7-bis(methoxycarbonyloxymethyl)-3-tricyclo[3.2.1.02,4]oct-6-enyl]-2-methylprop-1-enyl] acetate |
|---|---|
| PubChem CID | 11524042 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [1-[(1S,2S,4R,5R)-6,7-bis(methoxycarbonyloxymethyl)-3-tricyclo[3.2.1.02,4]oct-6-enyl]-2-methylprop-1-enyl] acetate |
| SMILES | COC(=O)OCC1=C(COC(=O)OC)[C@@H]2C[C@H]1[C@H]1C(C(OC(C)=O)=C(C)C)[C@H]12 |
| InChI | InChI=1S/C20H26O8/c1-9(2)18(28-10(3)21)17-15-11-6-12(16(15)17)14(8-27-20(23)25-5)13(11)7-26-19(22)24-4/h11-12,15-17H,6-8H2,1-5H3/t11-,12+,15-,16+,17? |
| InChIKey | HJMZCYAIFCJSCK-WBQAGZKKSA-N |
| XLogP | 3.22 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|