C15H18O6 — CID 101098253
dimethyl 2-[(1S,4R)-3-(acetyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]propanedioate (PubChem CID 101098253) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is dimethyl 2-[(1S,4R)-3-(acetyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]propanedioate.
| Compound Name | dimethyl 2-[(1S,4R)-3-(acetyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]propanedioate |
|---|---|
| PubChem CID | 101098253 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | dimethyl 2-[(1S,4R)-3-(acetyloxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C1=C(COC(C)=O)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H18O6/c1-8(16)21-7-11-9-4-5-10(6-9)12(11)13(14(17)19-2)15(18)20-3/h4-5,9-10,13H,6-7H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | ZSXRUEBYQIRHEP-VHSXEESVSA-N |
| XLogP | 1.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|