C11H14N2 — CID 163480902
3,4a,5-trimethyl-5H-quinoxaline (PubChem CID 163480902) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 3,4a,5-trimethyl-5H-quinoxaline.
| Compound Name | 3,4a,5-trimethyl-5H-quinoxaline |
|---|---|
| PubChem CID | 163480902 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3,4a,5-trimethyl-5H-quinoxaline |
| SMILES | CC1=NC2(C)C(=CC=CC2C)N=C1 |
| InChI | InChI=1S/C11H14N2/c1-8-5-4-6-10-11(8,3)13-9(2)7-12-10/h4-8H,1-3H3 |
| InChIKey | CEKPWICAIUYVOZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |