C13H17ClN2O3 — CID 163482028
2-[(10S)-4-chloro-8,12-dioxa-1,5-diazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol (PubChem CID 163482028) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 2-[(10S)-4-chloro-8,12-dioxa-1,5-diazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol.
| Compound Name | 2-[(10S)-4-chloro-8,12-dioxa-1,5-diazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 163482028 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-[(10S)-4-chloro-8,12-dioxa-1,5-diazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol |
| SMILES | CC(C)(O)c1nc(Cl)cc2c1OC[C@@H]1COCCN21 |
| InChI | InChI=1S/C13H17ClN2O3/c1-13(2,17)12-11-9(5-10(14)15-12)16-3-4-18-6-8(16)7-19-11/h5,8,17H,3-4,6-7H2,1-2H3/t8-/m0/s1 |
| InChIKey | CFJJMWKPYMCNBS-QMMMGPOBSA-N |
| XLogP | 1.56 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|