C20H20N4O3 — CID 123759640
2-[4-(1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol (PubChem CID 123759640) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-[4-(1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol.
| Compound Name | 2-[4-(1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 123759640 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[4-(1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-ol |
| SMILES | CC(C)(O)c1nc(C2=C=C=Cc3[nH]ccc32)nc2c1OCC1COCCN21 |
| InChI | InChI=1S/C20H20N4O3/c1-20(2,25)17-16-19(24-8-9-26-10-12(24)11-27-16)23-18(22-17)14-4-3-5-15-13(14)6-7-21-15/h5-7,12,21,25H,8-11H2,1-2H3 |
| InChIKey | MXMYGBJCEKKMCJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |