C7H12O — CID 163483277
(3S)-3-ethyl-5-methyl-2,3-dihydrofuran (PubChem CID 163483277) has the molecular formula C7H12O and a molecular weight of 112.17 g/mol. Its IUPAC name is (3S)-3-ethyl-5-methyl-2,3-dihydrofuran.
| Compound Name | (3S)-3-ethyl-5-methyl-2,3-dihydrofuran |
|---|---|
| PubChem CID | 163483277 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | (3S)-3-ethyl-5-methyl-2,3-dihydrofuran |
| SMILES | CC[C@H]1C=C(C)OC1 |
| InChI | InChI=1S/C7H12O/c1-3-7-4-6(2)8-5-7/h4,7H,3,5H2,1-2H3/t7-/m0/s1 |
| InChIKey | CGKCBVOCRFWKNB-ZETCQYMHSA-N |
| XLogP | 1.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |