C8H16O2 — CID 144876595
4,6-dimethyl-4H-1,3-dioxine;ethane (PubChem CID 144876595) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is 4,6-dimethyl-4H-1,3-dioxine;ethane.
| Compound Name | 4,6-dimethyl-4H-1,3-dioxine;ethane |
|---|---|
| PubChem CID | 144876595 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 4,6-dimethyl-4H-1,3-dioxine;ethane |
| SMILES | CC.CC1=CC(C)OCO1 |
| InChI | InChI=1S/C6H10O2.C2H6/c1-5-3-6(2)8-4-7-5;1-2/h3,5H,4H2,1-2H3;1-2H3 |
| InChIKey | FUHWUTBBSARQMR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |