C30H31N5O2 — CID 163483651
N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-hydroxyphenyl]-3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methylbenzamide (PubChem CID 163483651) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-hydroxyphenyl]-3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methylbenzamide.
| Compound Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-hydroxyphenyl]-3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 163483651 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-hydroxyphenyl]-3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methylbenzamide |
| SMILES | CCN1CCN(Cc2ccc(NC(=O)c3ccc(C)c(C#Cc4cnc5ccccn45)c3)cc2O)CC1 |
| InChI | InChI=1S/C30H31N5O2/c1-3-33-14-16-34(17-15-33)21-25-9-11-26(19-28(25)36)32-30(37)24-8-7-22(2)23(18-24)10-12-27-20-31-29-6-4-5-13-35(27)29/h4-9,11,13,18-20,36H,3,14-17,21H2,1-2H3,(H,32,37) |
| InChIKey | CGRHPTOCLRGJMW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|