C29H27N5O2 — CID 58945635
3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methyl-N-[3-methyl-4-[(3-oxopiperazin-1-yl)methyl]phenyl]benzamide (PubChem CID 58945635) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methyl-N-[3-methyl-4-[(3-oxopiperazin-1-yl)methyl]phenyl]benzamide.
| Compound Name | 3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methyl-N-[3-methyl-4-[(3-oxopiperazin-1-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 58945635 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methyl-N-[3-methyl-4-[(3-oxopiperazin-1-yl)methyl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCNC(=O)C3)c(C)c2)cc1C#Cc1cnc2ccccn12 |
| InChI | InChI=1S/C29H27N5O2/c1-20-6-7-23(16-22(20)9-11-26-17-31-27-5-3-4-13-34(26)27)29(36)32-25-10-8-24(21(2)15-25)18-33-14-12-30-28(35)19-33/h3-8,10,13,15-17H,12,14,18-19H2,1-2H3,(H,30,35)(H,32,36) |
| InChIKey | ZKRVSDZWSAQCEA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|