About 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine
1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine (PubChem CID 163486860) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine.
Molecular Properties
| Compound Name | 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine |
| PubChem CID | 163486860 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine |
| SMILES | CC(C)c1ccncc1.CC(C)c1cnn(C)c1 |
| InChI | InChI=1S/C8H11N.C7H12N2/c1-7(2)8-3-5-9-6-4-8;1-6(2)7-4-8-9(3)5-7/h3-7H,1-2H3;4-6H,1-3H3 |
| InChIKey | CJGWYCCAWZEKGG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine?
The IUPAC name of 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine (CID 163486860) is 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine.
What is the SMILES notation for 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine?
The canonical SMILES for 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine is CC(C)c1ccncc1.CC(C)c1cnn(C)c1.
What is the InChIKey of 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine?
The InChIKey is CJGWYCCAWZEKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C7H12N2/c1-7(2)8-3-5-9-6-4-8;1-6(2)7-4-8-9(3)5-7/h3-7H,1-2H3;4-6H,1-3H3.
What are the key properties of 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine?
1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine has a molecular weight of 245.37 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propan-2-ylpyrazole;4-propan-2-ylpyridine is sourced from PubChem (CID 163486860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).