C12H19NO2 — CID 167569960
2-methyl-1,3-dioxolane;4-propan-2-ylpyridine (PubChem CID 167569960) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-methyl-1,3-dioxolane;4-propan-2-ylpyridine.
| Compound Name | 2-methyl-1,3-dioxolane;4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 167569960 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-methyl-1,3-dioxolane;4-propan-2-ylpyridine |
| SMILES | CC(C)c1ccncc1.CC1OCCO1 |
| InChI | InChI=1S/C8H11N.C4H8O2/c1-7(2)8-3-5-9-6-4-8;1-4-5-2-3-6-4/h3-7H,1-2H3;4H,2-3H2,1H3 |
| InChIKey | FTTVDLPKFNWSCU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |