C28H29N5O4 — CID 163486986
N-[4-(2-aminooxiran-2-yl)phenyl]-2-imino-2-[2-[[4-(morpholine-4-carbonyl)phenyl]methylamino]phenyl]acetamide (PubChem CID 163486986) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is N-[4-(2-aminooxiran-2-yl)phenyl]-2-imino-2-[2-[[4-(morpholine-4-carbonyl)phenyl]methylamino]phenyl]acetamide.
| Compound Name | N-[4-(2-aminooxiran-2-yl)phenyl]-2-imino-2-[2-[[4-(morpholine-4-carbonyl)phenyl]methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 163486986 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | N-[4-(2-aminooxiran-2-yl)phenyl]-2-imino-2-[2-[[4-(morpholine-4-carbonyl)phenyl]methylamino]phenyl]acetamide |
| SMILES | [H]/N=C(/C(=O)Nc1ccc(C2(N)CO2)cc1)c1ccccc1NCc1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H29N5O4/c29-25(26(34)32-22-11-9-21(10-12-22)28(30)18-37-28)23-3-1-2-4-24(23)31-17-19-5-7-20(8-6-19)27(35)33-13-15-36-16-14-33/h1-12,29,31H,13-18,30H2,(H,32,34)/b29-25+ |
| InChIKey | CJJOVJRCBBMNRK-XLVZBRSZSA-N |
| XLogP | 2.92 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|