C30H36N4O — CID 143870865
2-[2-[(4-tert-butylphenyl)methylamino]phenyl]-2-imino-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 143870865) has the molecular formula C30H36N4O and a molecular weight of 468.65 g/mol. Its IUPAC name is 2-[2-[(4-tert-butylphenyl)methylamino]phenyl]-2-imino-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[2-[(4-tert-butylphenyl)methylamino]phenyl]-2-imino-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 143870865 |
| Molecular Formula | C30H36N4O |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 2-[2-[(4-tert-butylphenyl)methylamino]phenyl]-2-imino-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(N2CCCCC2)cc1)c1ccccc1NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H36N4O/c1-30(2,3)23-13-11-22(12-14-23)21-32-27-10-6-5-9-26(27)28(31)29(35)33-24-15-17-25(18-16-24)34-19-7-4-8-20-34/h5-6,9-18,31-32H,4,7-8,19-21H2,1-3H3,(H,33,35)/b31-28- |
| InChIKey | ORSSCQKUMCVTTI-PNOGMODKSA-N |
| XLogP | 6.59 |
| TPSA | 68.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|