C27H30N4OS — CID 143870903
2-imino-2-[2-[(4-methylsulfanylphenyl)methylamino]phenyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 143870903) has the molecular formula C27H30N4OS and a molecular weight of 458.63 g/mol. Its IUPAC name is 2-imino-2-[2-[(4-methylsulfanylphenyl)methylamino]phenyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-imino-2-[2-[(4-methylsulfanylphenyl)methylamino]phenyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 143870903 |
| Molecular Formula | C27H30N4OS |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 2-imino-2-[2-[(4-methylsulfanylphenyl)methylamino]phenyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(N2CCCCC2)cc1)c1ccccc1NCc1ccc(SC)cc1 |
| InChI | InChI=1S/C27H30N4OS/c1-33-23-15-9-20(10-16-23)19-29-25-8-4-3-7-24(25)26(28)27(32)30-21-11-13-22(14-12-21)31-17-5-2-6-18-31/h3-4,7-16,28-29H,2,5-6,17-19H2,1H3,(H,30,32)/b28-26- |
| InChIKey | CTVCJCLTFVGOBR-SGEDCAFJSA-N |
| XLogP | 6.02 |
| TPSA | 68.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|