C13H20BClN2O2 — CID 163488236
N'-(4-chlorophenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanediamine (PubChem CID 163488236) has the molecular formula C13H20BClN2O2 and a molecular weight of 282.58 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanediamine.
| Compound Name | N'-(4-chlorophenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanediamine |
|---|---|
| PubChem CID | 163488236 |
| Molecular Formula | C13H20BClN2O2 |
| Molecular Weight | 282.58 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | N'-(4-chlorophenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanediamine |
| SMILES | CC1(C)OB(NCNc2ccc(Cl)cc2)OC1(C)C |
| InChI | InChI=1S/C13H20BClN2O2/c1-12(2)13(3,4)19-14(18-12)17-9-16-11-7-5-10(15)6-8-11/h5-8,16-17H,9H2,1-4H3 |
| InChIKey | CKJWJCVMRRIBNW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|