C10H16O3S — CID 163489781
8-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-2H-thiochromen-6-ol (PubChem CID 163489781) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is 8-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-2H-thiochromen-6-ol.
| Compound Name | 8-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-2H-thiochromen-6-ol |
|---|---|
| PubChem CID | 163489781 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 8-methyl-1,1-dioxo-3,4,5,6,7,8-hexahydro-2H-thiochromen-6-ol |
| SMILES | CC1CC(O)CC2=C1S(=O)(=O)CCC2 |
| InChI | InChI=1S/C10H16O3S/c1-7-5-9(11)6-8-3-2-4-14(12,13)10(7)8/h7,9,11H,2-6H2,1H3 |
| InChIKey | CLPLUKSEXUGPQD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |